About cyanic acid;ethyl 2-methylprop-2-enoate
cyanic acid;ethyl 2-methylprop-2-enoate (PubChem CID 172737974) has the molecular formula C7H11NO3
and a molecular weight of 157.17 g/mol. Its IUPAC name is cyanic acid;ethyl 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | cyanic acid;ethyl 2-methylprop-2-enoate |
| PubChem CID | 172737974 |
| Molecular Formula | C7H11NO3 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | cyanic acid;ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC.N#CO |
| InChI | InChI=1S/C6H10O2.CHNO/c1-4-8-6(7)5(2)3;2-1-3/h2,4H2,1,3H3;3H |
| InChIKey | IRXBHLHRNNFTCX-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze cyanic acid;ethyl 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyanic acid;ethyl 2-methylprop-2-enoate?
The IUPAC name of cyanic acid;ethyl 2-methylprop-2-enoate (CID 172737974) is cyanic acid;ethyl 2-methylprop-2-enoate.
What is the SMILES notation for cyanic acid;ethyl 2-methylprop-2-enoate?
The canonical SMILES for cyanic acid;ethyl 2-methylprop-2-enoate is C=C(C)C(=O)OCC.N#CO.
What is the InChIKey of cyanic acid;ethyl 2-methylprop-2-enoate?
The InChIKey is IRXBHLHRNNFTCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O2.CHNO/c1-4-8-6(7)5(2)3;2-1-3/h2,4H2,1,3H3;3H.
What are the key properties of cyanic acid;ethyl 2-methylprop-2-enoate?
cyanic acid;ethyl 2-methylprop-2-enoate has a molecular weight of 157.17 g/mol, XLogP of 0.97, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyanic acid;ethyl 2-methylprop-2-enoate is sourced from PubChem (CID 172737974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).