C14H16O6 — CID 66831473
ethyl 2-methylprop-2-enoate;phthalic acid (PubChem CID 66831473) has the molecular formula C14H16O6 and a molecular weight of 280.28 g/mol. Its IUPAC name is ethyl 2-methylprop-2-enoate;phthalic acid.
| Compound Name | ethyl 2-methylprop-2-enoate;phthalic acid |
|---|---|
| PubChem CID | 66831473 |
| Molecular Formula | C14H16O6 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | ethyl 2-methylprop-2-enoate;phthalic acid |
| SMILES | C=C(C)C(=O)OCC.O=C(O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C8H6O4.C6H10O2/c9-7(10)5-3-1-2-4-6(5)8(11)12;1-4-8-6(7)5(2)3/h1-4H,(H,9,10)(H,11,12);2,4H2,1,3H3 |
| InChIKey | LUIDITKYBJCCHH-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|