C24H34NO8+ — CID 159230948
diethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium;2-[2-(2-methylprop-2-enoyloxy)ethoxycarbonyl]benzoic acid (PubChem CID 159230948) has the molecular formula C24H34NO8+ and a molecular weight of 464.54 g/mol. Its IUPAC name is diethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium;2-[2-(2-methylprop-2-enoyloxy)ethoxycarbonyl]benzoic acid.
| Compound Name | diethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium;2-[2-(2-methylprop-2-enoyloxy)ethoxycarbonyl]benzoic acid |
|---|---|
| PubChem CID | 159230948 |
| Molecular Formula | C24H34NO8+ |
| Molecular Weight | 464.54 g/mol |
| Exact Mass | 464.23 |
| IUPAC Name | diethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium;2-[2-(2-methylprop-2-enoyloxy)ethoxycarbonyl]benzoic acid |
| SMILES | C=C(C)C(=O)OCCOC(=O)c1ccccc1C(=O)O.C=C(C)C(=O)OCC[NH+](CC)CC |
| InChI | InChI=1S/C14H14O6.C10H19NO2/c1-9(2)13(17)19-7-8-20-14(18)11-6-4-3-5-10(11)12(15)16;1-5-11(6-2)7-8-13-10(12)9(3)4/h3-6H,1,7-8H2,2H3,(H,15,16);3,5-8H2,1-2,4H3/p+1 |
| InChIKey | SUZOGXCNYYCILO-UHFFFAOYSA-O |
| XLogP | 1.69 |
| TPSA | 120.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.54 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|