C17H20O7 — CID 151164300
1-O-(3-hydroxypropyl) 2-O-[2-(2-methylprop-2-enoyloxy)ethyl] benzene-1,2-dicarboxylate (PubChem CID 151164300) has the molecular formula C17H20O7 and a molecular weight of 336.34 g/mol. Its IUPAC name is 1-O-(3-hydroxypropyl) 2-O-[2-(2-methylprop-2-enoyloxy)ethyl] benzene-1,2-dicarboxylate.
| Compound Name | 1-O-(3-hydroxypropyl) 2-O-[2-(2-methylprop-2-enoyloxy)ethyl] benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 151164300 |
| Molecular Formula | C17H20O7 |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | 1-O-(3-hydroxypropyl) 2-O-[2-(2-methylprop-2-enoyloxy)ethyl] benzene-1,2-dicarboxylate |
| SMILES | C=C(C)C(=O)OCCOC(=O)c1ccccc1C(=O)OCCCO |
| InChI | InChI=1S/C17H20O7/c1-12(2)15(19)23-10-11-24-17(21)14-7-4-3-6-13(14)16(20)22-9-5-8-18/h3-4,6-7,18H,1,5,8-11H2,2H3 |
| InChIKey | NAXSILFIAVVFRM-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|