C22H20Cl2O10 — CID 3023460
bis[2-(2-methylprop-2-enoyloxy)ethyl] 2,5-dicarbonochloridoylbenzene-1,4-dicarboxylate (PubChem CID 3023460) has the molecular formula C22H20Cl2O10 and a molecular weight of 515.30 g/mol. Its IUPAC name is bis[2-(2-methylprop-2-enoyloxy)ethyl] 2,5-dicarbonochloridoylbenzene-1,4-dicarboxylate.
| Compound Name | bis[2-(2-methylprop-2-enoyloxy)ethyl] 2,5-dicarbonochloridoylbenzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 3023460 |
| Molecular Formula | C22H20Cl2O10 |
| Molecular Weight | 515.30 g/mol |
| Exact Mass | 514.04 |
| IUPAC Name | bis[2-(2-methylprop-2-enoyloxy)ethyl] 2,5-dicarbonochloridoylbenzene-1,4-dicarboxylate |
| SMILES | C=C(C)C(=O)OCCOC(=O)c1cc(C(=O)Cl)c(C(=O)OCCOC(=O)C(=C)C)cc1C(=O)Cl |
| InChI | InChI=1S/C22H20Cl2O10/c1-11(2)19(27)31-5-7-33-21(29)15-9-14(18(24)26)16(10-13(15)17(23)25)22(30)34-8-6-32-20(28)12(3)4/h9-10H,1,3,5-8H2,2,4H3 |
| InChIKey | SCQIJALTNRNFIM-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 139.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.30 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|