C13H11I3O4 — CID 101240629
2-(2-methylprop-2-enoyloxy)ethyl 3,4,5-triiodobenzoate (PubChem CID 101240629) has the molecular formula C13H11I3O4 and a molecular weight of 611.94 g/mol. Its IUPAC name is 2-(2-methylprop-2-enoyloxy)ethyl 3,4,5-triiodobenzoate.
| Compound Name | 2-(2-methylprop-2-enoyloxy)ethyl 3,4,5-triiodobenzoate |
|---|---|
| PubChem CID | 101240629 |
| Molecular Formula | C13H11I3O4 |
| Molecular Weight | 611.94 g/mol |
| Exact Mass | 611.78 |
| IUPAC Name | 2-(2-methylprop-2-enoyloxy)ethyl 3,4,5-triiodobenzoate |
| SMILES | C=C(C)C(=O)OCCOC(=O)c1cc(I)c(I)c(I)c1 |
| InChI | InChI=1S/C13H11I3O4/c1-7(2)12(17)19-3-4-20-13(18)8-5-9(14)11(16)10(15)6-8/h5-6H,1,3-4H2,2H3 |
| InChIKey | GOPUOKBODKHRLK-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.94 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|