C17H14O9 — CID 118282780
5-O-methyl 6-O-[2-(2-methylprop-2-enoyloxy)ethyl] 1,3-dioxo-2-benzofuran-5,6-dicarboxylate (PubChem CID 118282780) has the molecular formula C17H14O9 and a molecular weight of 362.29 g/mol. Its IUPAC name is 5-O-methyl 6-O-[2-(2-methylprop-2-enoyloxy)ethyl] 1,3-dioxo-2-benzofuran-5,6-dicarboxylate.
| Compound Name | 5-O-methyl 6-O-[2-(2-methylprop-2-enoyloxy)ethyl] 1,3-dioxo-2-benzofuran-5,6-dicarboxylate |
|---|---|
| PubChem CID | 118282780 |
| Molecular Formula | C17H14O9 |
| Molecular Weight | 362.29 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | 5-O-methyl 6-O-[2-(2-methylprop-2-enoyloxy)ethyl] 1,3-dioxo-2-benzofuran-5,6-dicarboxylate |
| SMILES | C=C(C)C(=O)OCCOC(=O)c1cc2c(cc1C(=O)OC)C(=O)OC2=O |
| InChI | InChI=1S/C17H14O9/c1-8(2)13(18)24-4-5-25-15(20)10-7-12-11(16(21)26-17(12)22)6-9(10)14(19)23-3/h6-7H,1,4-5H2,2-3H3 |
| InChIKey | FLNBWYWHDMDRPG-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.29 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|