C28H24Cl2O11 — CID 132577709
2-(2-methylprop-2-enoyloxy)ethyl 2-carbonochloridoyl-4-[3-carbonochloridoyl-4-[2-(2-methylprop-2-enoyloxy)ethoxycarbonyl]phenoxy]benzoate (PubChem CID 132577709) has the molecular formula C28H24Cl2O11 and a molecular weight of 607.40 g/mol. Its IUPAC name is 2-(2-methylprop-2-enoyloxy)ethyl 2-carbonochloridoyl-4-[3-carbonochloridoyl-4-[2-(2-methylprop-2-enoyloxy)ethoxycarbonyl]phenoxy]benzoate.
| Compound Name | 2-(2-methylprop-2-enoyloxy)ethyl 2-carbonochloridoyl-4-[3-carbonochloridoyl-4-[2-(2-methylprop-2-enoyloxy)ethoxycarbonyl]phenoxy]benzoate |
|---|---|
| PubChem CID | 132577709 |
| Molecular Formula | C28H24Cl2O11 |
| Molecular Weight | 607.40 g/mol |
| Exact Mass | 606.07 |
| IUPAC Name | 2-(2-methylprop-2-enoyloxy)ethyl 2-carbonochloridoyl-4-[3-carbonochloridoyl-4-[2-(2-methylprop-2-enoyloxy)ethoxycarbonyl]phenoxy]benzoate |
| SMILES | C=C(C)C(=O)OCCOC(=O)c1ccc(Oc2ccc(C(=O)OCCOC(=O)C(=C)C)c(C(=O)Cl)c2)cc1C(=O)Cl |
| InChI | InChI=1S/C28H24Cl2O11/c1-15(2)25(33)37-9-11-39-27(35)19-7-5-17(13-21(19)23(29)31)41-18-6-8-20(22(14-18)24(30)32)28(36)40-12-10-38-26(34)16(3)4/h5-8,13-14H,1,3,9-12H2,2,4H3 |
| InChIKey | KCZUZTSERNLCOB-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 148.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.40 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|