C34H36O14 — CID 129258150
bis[4-hydroxy-3-[2-(2-methylprop-2-enoyloxy)ethoxycarbonyl]phenyl] cyclohexane-1,4-dicarboxylate (PubChem CID 129258150) has the molecular formula C34H36O14 and a molecular weight of 668.65 g/mol. Its IUPAC name is bis[4-hydroxy-3-[2-(2-methylprop-2-enoyloxy)ethoxycarbonyl]phenyl] cyclohexane-1,4-dicarboxylate.
| Compound Name | bis[4-hydroxy-3-[2-(2-methylprop-2-enoyloxy)ethoxycarbonyl]phenyl] cyclohexane-1,4-dicarboxylate |
|---|---|
| PubChem CID | 129258150 |
| Molecular Formula | C34H36O14 |
| Molecular Weight | 668.65 g/mol |
| Exact Mass | 668.21 |
| IUPAC Name | bis[4-hydroxy-3-[2-(2-methylprop-2-enoyloxy)ethoxycarbonyl]phenyl] cyclohexane-1,4-dicarboxylate |
| SMILES | C=C(C)C(=O)OCCOC(=O)c1cc(OC(=O)C2CCC(C(=O)Oc3ccc(O)c(C(=O)OCCOC(=O)C(=C)C)c3)CC2)ccc1O |
| InChI | InChI=1S/C34H36O14/c1-19(2)29(37)43-13-15-45-33(41)25-17-23(9-11-27(25)35)47-31(39)21-5-7-22(8-6-21)32(40)48-24-10-12-28(36)26(18-24)34(42)46-16-14-44-30(38)20(3)4/h9-12,17-18,21-22,35-36H,1,3,5-8,13-16H2,2,4H3 |
| InChIKey | LJFRYBYZGNOJKF-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 198.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.65 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|