C22H28O7 — CID 89073253
[4-[4-(2-methylprop-2-enoyloxy)butoxycarbonyloxy]phenyl] cyclohexanecarboxylate (PubChem CID 89073253) has the molecular formula C22H28O7 and a molecular weight of 404.46 g/mol. Its IUPAC name is [4-[4-(2-methylprop-2-enoyloxy)butoxycarbonyloxy]phenyl] cyclohexanecarboxylate.
| Compound Name | [4-[4-(2-methylprop-2-enoyloxy)butoxycarbonyloxy]phenyl] cyclohexanecarboxylate |
|---|---|
| PubChem CID | 89073253 |
| Molecular Formula | C22H28O7 |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | [4-[4-(2-methylprop-2-enoyloxy)butoxycarbonyloxy]phenyl] cyclohexanecarboxylate |
| SMILES | C=C(C)C(=O)OCCCCOC(=O)Oc1ccc(OC(=O)C2CCCCC2)cc1 |
| InChI | InChI=1S/C22H28O7/c1-16(2)20(23)26-14-6-7-15-27-22(25)29-19-12-10-18(11-13-19)28-21(24)17-8-4-3-5-9-17/h10-13,17H,1,3-9,14-15H2,2H3 |
| InChIKey | UXPVOOJUGDEMAB-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|