C33H50O4 — CID 155716278
[3-methyl-4-[6-(2-methylprop-2-enoyloxy)hexyl]phenyl] 4-(4-propylcyclohexyl)cyclohexane-1-carboxylate (PubChem CID 155716278) has the molecular formula C33H50O4 and a molecular weight of 510.76 g/mol. Its IUPAC name is [3-methyl-4-[6-(2-methylprop-2-enoyloxy)hexyl]phenyl] 4-(4-propylcyclohexyl)cyclohexane-1-carboxylate.
| Compound Name | [3-methyl-4-[6-(2-methylprop-2-enoyloxy)hexyl]phenyl] 4-(4-propylcyclohexyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 155716278 |
| Molecular Formula | C33H50O4 |
| Molecular Weight | 510.76 g/mol |
| Exact Mass | 510.37 |
| IUPAC Name | [3-methyl-4-[6-(2-methylprop-2-enoyloxy)hexyl]phenyl] 4-(4-propylcyclohexyl)cyclohexane-1-carboxylate |
| SMILES | C=C(C)C(=O)OCCCCCCc1ccc(OC(=O)C2CCC(C3CCC(CCC)CC3)CC2)cc1C |
| InChI | InChI=1S/C33H50O4/c1-5-10-26-12-14-28(15-13-26)29-16-18-30(19-17-29)33(35)37-31-21-20-27(25(4)23-31)11-8-6-7-9-22-36-32(34)24(2)3/h20-21,23,26,28-30H,2,5-19,22H2,1,3-4H3 |
| InChIKey | VTXXOMLAEBZJQJ-UHFFFAOYSA-N |
| XLogP | 8.54 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.76 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|