C29H46O4 — CID 142301465
ethane;(4-prop-2-enoyloxyphenyl) 4-(4-propylcyclohexyl)cyclohexane-1-carboxylate (PubChem CID 142301465) has the molecular formula C29H46O4 and a molecular weight of 458.68 g/mol. Its IUPAC name is ethane;(4-prop-2-enoyloxyphenyl) 4-(4-propylcyclohexyl)cyclohexane-1-carboxylate.
| Compound Name | ethane;(4-prop-2-enoyloxyphenyl) 4-(4-propylcyclohexyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 142301465 |
| Molecular Formula | C29H46O4 |
| Molecular Weight | 458.68 g/mol |
| Exact Mass | 458.34 |
| IUPAC Name | ethane;(4-prop-2-enoyloxyphenyl) 4-(4-propylcyclohexyl)cyclohexane-1-carboxylate |
| SMILES | C=CC(=O)Oc1ccc(OC(=O)C2CCC(C3CCC(CCC)CC3)CC2)cc1.CC.CC |
| InChI | InChI=1S/C25H34O4.2C2H6/c1-3-5-18-6-8-19(9-7-18)20-10-12-21(13-11-20)25(27)29-23-16-14-22(15-17-23)28-24(26)4-2;2*1-2/h4,14-21H,2-3,5-13H2,1H3;2*1-2H3 |
| InChIKey | WFXGVYGLAHNCCH-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.68 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|