C24H34O4 — CID 23335039
(4-acetyloxyphenyl) 4-(4-propylcyclohexyl)cyclohexane-1-carboxylate (PubChem CID 23335039) has the molecular formula C24H34O4 and a molecular weight of 386.53 g/mol. Its IUPAC name is (4-acetyloxyphenyl) 4-(4-propylcyclohexyl)cyclohexane-1-carboxylate.
| Compound Name | (4-acetyloxyphenyl) 4-(4-propylcyclohexyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 23335039 |
| Molecular Formula | C24H34O4 |
| Molecular Weight | 386.53 g/mol |
| Exact Mass | 386.25 |
| IUPAC Name | (4-acetyloxyphenyl) 4-(4-propylcyclohexyl)cyclohexane-1-carboxylate |
| SMILES | CCCC1CCC(C2CCC(C(=O)Oc3ccc(OC(C)=O)cc3)CC2)CC1 |
| InChI | InChI=1S/C24H34O4/c1-3-4-18-5-7-19(8-6-18)20-9-11-21(12-10-20)24(26)28-23-15-13-22(14-16-23)27-17(2)25/h13-16,18-21H,3-12H2,1-2H3 |
| InChIKey | NTLADJKWWWVGGL-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.53 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|