About (4-propanoyloxyphenyl) 4-(4-octylcyclohexyl)cyclohexane-1-carboxylate
(4-propanoyloxyphenyl) 4-(4-octylcyclohexyl)cyclohexane-1-carboxylate (PubChem CID 23334826) has the molecular formula C30H46O4
and a molecular weight of 470.69 g/mol. Its IUPAC name is (4-propanoyloxyphenyl) 4-(4-octylcyclohexyl)cyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | (4-propanoyloxyphenyl) 4-(4-octylcyclohexyl)cyclohexane-1-carboxylate |
| PubChem CID | 23334826 |
| Molecular Formula | C30H46O4 |
| Molecular Weight | 470.69 g/mol |
| Exact Mass | 470.34 |
| IUPAC Name | (4-propanoyloxyphenyl) 4-(4-octylcyclohexyl)cyclohexane-1-carboxylate |
| SMILES | CCCCCCCCC1CCC(C2CCC(C(=O)Oc3ccc(OC(=O)CC)cc3)CC2)CC1 |
| InChI | InChI=1S/C30H46O4/c1-3-5-6-7-8-9-10-23-11-13-24(14-12-23)25-15-17-26(18-16-25)30(32)34-28-21-19-27(20-22-28)33-29(31)4-2/h19-26H,3-18H2,1-2H3 |
| InChIKey | ZTEPEOUOYIOBFY-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 470.69 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-propanoyloxyphenyl) 4-(4-octylcyclohexyl)cyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-propanoyloxyphenyl) 4-(4-octylcyclohexyl)cyclohexane-1-carboxylate?
The IUPAC name of (4-propanoyloxyphenyl) 4-(4-octylcyclohexyl)cyclohexane-1-carboxylate (CID 23334826) is (4-propanoyloxyphenyl) 4-(4-octylcyclohexyl)cyclohexane-1-carboxylate.
What is the SMILES notation for (4-propanoyloxyphenyl) 4-(4-octylcyclohexyl)cyclohexane-1-carboxylate?
The canonical SMILES for (4-propanoyloxyphenyl) 4-(4-octylcyclohexyl)cyclohexane-1-carboxylate is CCCCCCCCC1CCC(C2CCC(C(=O)Oc3ccc(OC(=O)CC)cc3)CC2)CC1.
What is the InChIKey of (4-propanoyloxyphenyl) 4-(4-octylcyclohexyl)cyclohexane-1-carboxylate?
The InChIKey is ZTEPEOUOYIOBFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H46O4/c1-3-5-6-7-8-9-10-23-11-13-24(14-12-23)25-15-17-26(18-16-25)30(32)34-28-21-19-27(20-22-28)33-29(31)4-2/h19-26H,3-18H2,1-2H3.
What are the key properties of (4-propanoyloxyphenyl) 4-(4-octylcyclohexyl)cyclohexane-1-carboxylate?
(4-propanoyloxyphenyl) 4-(4-octylcyclohexyl)cyclohexane-1-carboxylate has a molecular weight of 470.69 g/mol, XLogP of 8.27, 12 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-propanoyloxyphenyl) 4-(4-octylcyclohexyl)cyclohexane-1-carboxylate is sourced from PubChem (CID 23334826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).