C28H40O3 — CID 59695730
[4-(2-oxobut-3-enyl)phenyl] 4-(4-pentylcyclohexyl)cyclohexane-1-carboxylate (PubChem CID 59695730) has the molecular formula C28H40O3 and a molecular weight of 424.63 g/mol. Its IUPAC name is [4-(2-oxobut-3-enyl)phenyl] 4-(4-pentylcyclohexyl)cyclohexane-1-carboxylate.
| Compound Name | [4-(2-oxobut-3-enyl)phenyl] 4-(4-pentylcyclohexyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 59695730 |
| Molecular Formula | C28H40O3 |
| Molecular Weight | 424.63 g/mol |
| Exact Mass | 424.30 |
| IUPAC Name | [4-(2-oxobut-3-enyl)phenyl] 4-(4-pentylcyclohexyl)cyclohexane-1-carboxylate |
| SMILES | C=CC(=O)Cc1ccc(OC(=O)C2CCC(C3CCC(CCCCC)CC3)CC2)cc1 |
| InChI | InChI=1S/C28H40O3/c1-3-5-6-7-21-8-12-23(13-9-21)24-14-16-25(17-15-24)28(30)31-27-18-10-22(11-19-27)20-26(29)4-2/h4,10-11,18-19,21,23-25H,2-3,5-9,12-17,20H2,1H3 |
| InChIKey | ZVDFYLZKTMATTR-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.63 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|