C24H32O4 — CID 167706278
[4-(prop-2-enoyloxymethyl)phenyl] 4-(4-methylcyclohexyl)cyclohexane-1-carboxylate (PubChem CID 167706278) has the molecular formula C24H32O4 and a molecular weight of 384.52 g/mol. Its IUPAC name is [4-(prop-2-enoyloxymethyl)phenyl] 4-(4-methylcyclohexyl)cyclohexane-1-carboxylate.
| Compound Name | [4-(prop-2-enoyloxymethyl)phenyl] 4-(4-methylcyclohexyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 167706278 |
| Molecular Formula | C24H32O4 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | [4-(prop-2-enoyloxymethyl)phenyl] 4-(4-methylcyclohexyl)cyclohexane-1-carboxylate |
| SMILES | C=CC(=O)OCc1ccc(OC(=O)C2CCC(C3CCC(C)CC3)CC2)cc1 |
| InChI | InChI=1S/C24H32O4/c1-3-23(25)27-16-18-6-14-22(15-7-18)28-24(26)21-12-10-20(11-13-21)19-8-4-17(2)5-9-19/h3,6-7,14-15,17,19-21H,1,4-5,8-13,16H2,2H3 |
| InChIKey | MAAFHMKEPAXZPX-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|