C49H54O8 — CID 91610995
cyclopentane;[4-[4-[4-(2-methylprop-2-enoyloxymethyl)phenyl]phenyl]phenyl]methyl 2-methylprop-2-enoate;[4-(prop-2-enoyloxymethyl)phenyl] cyclopentanecarboxylate (PubChem CID 91610995) has the molecular formula C49H54O8 and a molecular weight of 770.96 g/mol. Its IUPAC name is cyclopentane;[4-[4-[4-(2-methylprop-2-enoyloxymethyl)phenyl]phenyl]phenyl]methyl 2-methylprop-2-enoate;[4-(prop-2-enoyloxymethyl)phenyl] cyclopentanecarboxylate.
| Compound Name | cyclopentane;[4-[4-[4-(2-methylprop-2-enoyloxymethyl)phenyl]phenyl]phenyl]methyl 2-methylprop-2-enoate;[4-(prop-2-enoyloxymethyl)phenyl] cyclopentanecarboxylate |
|---|---|
| PubChem CID | 91610995 |
| Molecular Formula | C49H54O8 |
| Molecular Weight | 770.96 g/mol |
| Exact Mass | 770.38 |
| IUPAC Name | cyclopentane;[4-[4-[4-(2-methylprop-2-enoyloxymethyl)phenyl]phenyl]phenyl]methyl 2-methylprop-2-enoate;[4-(prop-2-enoyloxymethyl)phenyl] cyclopentanecarboxylate |
| SMILES | C1CCCC1.C=C(C)C(=O)OCc1ccc(-c2ccc(-c3ccc(COC(=O)C(=C)C)cc3)cc2)cc1.C=CC(=O)OCc1ccc(OC(=O)C2CCCC2)cc1 |
| InChI | InChI=1S/C28H26O4.C16H18O4.C5H10/c1-19(2)27(29)31-17-21-5-9-23(10-6-21)25-13-15-26(16-14-25)24-11-7-22(8-12-24)18-32-28(30)20(3)4;1-2-15(17)19-11-12-7-9-14(10-8-12)20-16(18)13-5-3-4-6-13;1-2-4-5-3-1/h5-16H,1,3,17-18H2,2,4H3;2,7-10,13H,1,3-6,11H2;1-5H2 |
| InChIKey | WWTYOVJZRNJOON-UHFFFAOYSA-N |
| XLogP | 11.22 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.96 |
| LogP ≤ 5 | 11.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|