C32H26O5 — CID 155219776
[4-[4-[[4-(4-prop-2-enoyloxyphenyl)phenoxy]methyl]phenyl]phenyl] 2-methylprop-2-enoate (PubChem CID 155219776) has the molecular formula C32H26O5 and a molecular weight of 490.56 g/mol. Its IUPAC name is [4-[4-[[4-(4-prop-2-enoyloxyphenyl)phenoxy]methyl]phenyl]phenyl] 2-methylprop-2-enoate.
| Compound Name | [4-[4-[[4-(4-prop-2-enoyloxyphenyl)phenoxy]methyl]phenyl]phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 155219776 |
| Molecular Formula | C32H26O5 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | [4-[4-[[4-(4-prop-2-enoyloxyphenyl)phenoxy]methyl]phenyl]phenyl] 2-methylprop-2-enoate |
| SMILES | C=CC(=O)Oc1ccc(-c2ccc(OCc3ccc(-c4ccc(OC(=O)C(=C)C)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C32H26O5/c1-4-31(33)36-29-17-11-27(12-18-29)25-9-15-28(16-10-25)35-21-23-5-7-24(8-6-23)26-13-19-30(20-14-26)37-32(34)22(2)3/h4-20H,1-2,21H2,3H3 |
| InChIKey | LWSJWPKWXYRBMG-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|