C19H16O4 — CID 89212422
[4-(4-prop-2-enoyloxyphenyl)phenyl] 2-methylprop-2-enoate (PubChem CID 89212422) has the molecular formula C19H16O4 and a molecular weight of 308.33 g/mol. Its IUPAC name is [4-(4-prop-2-enoyloxyphenyl)phenyl] 2-methylprop-2-enoate.
| Compound Name | [4-(4-prop-2-enoyloxyphenyl)phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 89212422 |
| Molecular Formula | C19H16O4 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | [4-(4-prop-2-enoyloxyphenyl)phenyl] 2-methylprop-2-enoate |
| SMILES | C=CC(=O)Oc1ccc(-c2ccc(OC(=O)C(=C)C)cc2)cc1 |
| InChI | InChI=1S/C19H16O4/c1-4-18(20)22-16-9-5-14(6-10-16)15-7-11-17(12-8-15)23-19(21)13(2)3/h4-12H,1-2H2,3H3 |
| InChIKey | NWBDKVOWHQAOOV-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|