C28H28O8 — CID 134310367
bis[4-(prop-2-enoyloxymethyl)phenyl] cyclohexane-1,4-dicarboxylate (PubChem CID 134310367) has the molecular formula C28H28O8 and a molecular weight of 492.52 g/mol. Its IUPAC name is bis[4-(prop-2-enoyloxymethyl)phenyl] cyclohexane-1,4-dicarboxylate.
| Compound Name | bis[4-(prop-2-enoyloxymethyl)phenyl] cyclohexane-1,4-dicarboxylate |
|---|---|
| PubChem CID | 134310367 |
| Molecular Formula | C28H28O8 |
| Molecular Weight | 492.52 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | bis[4-(prop-2-enoyloxymethyl)phenyl] cyclohexane-1,4-dicarboxylate |
| SMILES | C=CC(=O)OCc1ccc(OC(=O)C2CCC(C(=O)Oc3ccc(COC(=O)C=C)cc3)CC2)cc1 |
| InChI | InChI=1S/C28H28O8/c1-3-25(29)33-17-19-5-13-23(14-6-19)35-27(31)21-9-11-22(12-10-21)28(32)36-24-15-7-20(8-16-24)18-34-26(30)4-2/h3-8,13-16,21-22H,1-2,9-12,17-18H2 |
| InChIKey | WWEWFOPRYLMBOJ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.52 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|