C35H46O6 — CID 59386500
1-O-(4-hexylphenyl) 4-O-[4-(6-prop-2-enoyloxyhexyl)phenyl] cyclohexane-1,4-dicarboxylate (PubChem CID 59386500) has the molecular formula C35H46O6 and a molecular weight of 562.75 g/mol. Its IUPAC name is 1-O-(4-hexylphenyl) 4-O-[4-(6-prop-2-enoyloxyhexyl)phenyl] cyclohexane-1,4-dicarboxylate.
| Compound Name | 1-O-(4-hexylphenyl) 4-O-[4-(6-prop-2-enoyloxyhexyl)phenyl] cyclohexane-1,4-dicarboxylate |
|---|---|
| PubChem CID | 59386500 |
| Molecular Formula | C35H46O6 |
| Molecular Weight | 562.75 g/mol |
| Exact Mass | 562.33 |
| IUPAC Name | 1-O-(4-hexylphenyl) 4-O-[4-(6-prop-2-enoyloxyhexyl)phenyl] cyclohexane-1,4-dicarboxylate |
| SMILES | C=CC(=O)OCCCCCCc1ccc(OC(=O)C2CCC(C(=O)Oc3ccc(CCCCCC)cc3)CC2)cc1 |
| InChI | InChI=1S/C35H46O6/c1-3-5-6-9-12-27-14-22-31(23-15-27)40-34(37)29-18-20-30(21-19-29)35(38)41-32-24-16-28(17-25-32)13-10-7-8-11-26-39-33(36)4-2/h4,14-17,22-25,29-30H,2-3,5-13,18-21,26H2,1H3 |
| InChIKey | FLIRXCVVHVPUFP-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.75 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|