C32H36O10 — CID 162495804
1-O-(4-methylphenyl) 4-O-[4-[2-[4-oxo-4-(2-prop-2-enoyloxyethoxy)butanoyl]oxyethyl]phenyl] cyclohexane-1,4-dicarboxylate (PubChem CID 162495804) has the molecular formula C32H36O10 and a molecular weight of 580.63 g/mol. Its IUPAC name is 1-O-(4-methylphenyl) 4-O-[4-[2-[4-oxo-4-(2-prop-2-enoyloxyethoxy)butanoyl]oxyethyl]phenyl] cyclohexane-1,4-dicarboxylate.
| Compound Name | 1-O-(4-methylphenyl) 4-O-[4-[2-[4-oxo-4-(2-prop-2-enoyloxyethoxy)butanoyl]oxyethyl]phenyl] cyclohexane-1,4-dicarboxylate |
|---|---|
| PubChem CID | 162495804 |
| Molecular Formula | C32H36O10 |
| Molecular Weight | 580.63 g/mol |
| Exact Mass | 580.23 |
| IUPAC Name | 1-O-(4-methylphenyl) 4-O-[4-[2-[4-oxo-4-(2-prop-2-enoyloxyethoxy)butanoyl]oxyethyl]phenyl] cyclohexane-1,4-dicarboxylate |
| SMILES | C=CC(=O)OCCOC(=O)CCC(=O)OCCc1ccc(OC(=O)C2CCC(C(=O)Oc3ccc(C)cc3)CC2)cc1 |
| InChI | InChI=1S/C32H36O10/c1-3-28(33)39-20-21-40-30(35)17-16-29(34)38-19-18-23-6-14-27(15-7-23)42-32(37)25-10-8-24(9-11-25)31(36)41-26-12-4-22(2)5-13-26/h3-7,12-15,24-25H,1,8-11,16-21H2,2H3 |
| InChIKey | YSSIAEXTZFYAQB-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.63 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|