C24H30O10 — CID 135188766
4-[4-[2-[4-(2-acetyloxyethoxy)-4-oxobutanoyl]oxyethyl]phenoxy]carbonylcyclohexane-1-carboxylic acid (PubChem CID 135188766) has the molecular formula C24H30O10 and a molecular weight of 478.49 g/mol. Its IUPAC name is 4-[4-[2-[4-(2-acetyloxyethoxy)-4-oxobutanoyl]oxyethyl]phenoxy]carbonylcyclohexane-1-carboxylic acid.
| Compound Name | 4-[4-[2-[4-(2-acetyloxyethoxy)-4-oxobutanoyl]oxyethyl]phenoxy]carbonylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 135188766 |
| Molecular Formula | C24H30O10 |
| Molecular Weight | 478.49 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | 4-[4-[2-[4-(2-acetyloxyethoxy)-4-oxobutanoyl]oxyethyl]phenoxy]carbonylcyclohexane-1-carboxylic acid |
| SMILES | CC(=O)OCCOC(=O)CCC(=O)OCCc1ccc(OC(=O)C2CCC(C(=O)O)CC2)cc1 |
| InChI | InChI=1S/C24H30O10/c1-16(25)31-14-15-33-22(27)11-10-21(26)32-13-12-17-2-8-20(9-3-17)34-24(30)19-6-4-18(5-7-19)23(28)29/h2-3,8-9,18-19H,4-7,10-15H2,1H3,(H,28,29) |
| InChIKey | XJGFJSPCXNANLH-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 142.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.49 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|