C23H29NO8 — CID 121291005
4-[4-[2-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]ethyl]phenoxy]carbonylcyclohexane-1-carboxylic acid (PubChem CID 121291005) has the molecular formula C23H29NO8 and a molecular weight of 447.48 g/mol. Its IUPAC name is 4-[4-[2-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]ethyl]phenoxy]carbonylcyclohexane-1-carboxylic acid.
| Compound Name | 4-[4-[2-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]ethyl]phenoxy]carbonylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 121291005 |
| Molecular Formula | C23H29NO8 |
| Molecular Weight | 447.48 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | 4-[4-[2-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]ethyl]phenoxy]carbonylcyclohexane-1-carboxylic acid |
| SMILES | C=C(C)C(=O)OCCNC(=O)OCCc1ccc(OC(=O)C2CCC(C(=O)O)CC2)cc1 |
| InChI | InChI=1S/C23H29NO8/c1-15(2)21(27)30-14-12-24-23(29)31-13-11-16-3-9-19(10-4-16)32-22(28)18-7-5-17(6-8-18)20(25)26/h3-4,9-10,17-18H,1,5-8,11-14H2,2H3,(H,24,29)(H,25,26) |
| InChIKey | MCQGWGGHACPTEN-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 128.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.48 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|