C16H21NO4 — CID 58004900
2-[2-(4-methylphenyl)ethoxycarbonylamino]ethyl 2-methylprop-2-enoate (PubChem CID 58004900) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is 2-[2-(4-methylphenyl)ethoxycarbonylamino]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[2-(4-methylphenyl)ethoxycarbonylamino]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 58004900 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | 2-[2-(4-methylphenyl)ethoxycarbonylamino]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCNC(=O)OCCc1ccc(C)cc1 |
| InChI | InChI=1S/C16H21NO4/c1-12(2)15(18)20-11-9-17-16(19)21-10-8-14-6-4-13(3)5-7-14/h4-7H,1,8-11H2,2-3H3,(H,17,19) |
| InChIKey | OYZCGWVADBZPJP-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|