C26H36N2O9 — CID 118331503
3-[2-[4-[2-[3-(2-methylprop-2-enoyloxy)propylcarbamoyloxy]ethoxy]phenyl]ethoxycarbonylamino]propyl 2-methylprop-2-enoate (PubChem CID 118331503) has the molecular formula C26H36N2O9 and a molecular weight of 520.58 g/mol. Its IUPAC name is 3-[2-[4-[2-[3-(2-methylprop-2-enoyloxy)propylcarbamoyloxy]ethoxy]phenyl]ethoxycarbonylamino]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[2-[4-[2-[3-(2-methylprop-2-enoyloxy)propylcarbamoyloxy]ethoxy]phenyl]ethoxycarbonylamino]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 118331503 |
| Molecular Formula | C26H36N2O9 |
| Molecular Weight | 520.58 g/mol |
| Exact Mass | 520.24 |
| IUPAC Name | 3-[2-[4-[2-[3-(2-methylprop-2-enoyloxy)propylcarbamoyloxy]ethoxy]phenyl]ethoxycarbonylamino]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCNC(=O)OCCOc1ccc(CCOC(=O)NCCCOC(=O)C(=C)C)cc1 |
| InChI | InChI=1S/C26H36N2O9/c1-19(2)23(29)34-14-5-12-27-25(31)36-16-11-21-7-9-22(10-8-21)33-17-18-37-26(32)28-13-6-15-35-24(30)20(3)4/h7-10H,1,3,5-6,11-18H2,2,4H3,(H,27,31)(H,28,32) |
| InChIKey | ONLVKBSWKNSHQS-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 138.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.58 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|