C19H19F9O3 — CID 88559938
2-[4-(4,4,5,5,6,6,7,7,7-nonafluoroheptoxy)phenyl]ethyl 2-methylprop-2-enoate (PubChem CID 88559938) has the molecular formula C19H19F9O3 and a molecular weight of 466.34 g/mol. Its IUPAC name is 2-[4-(4,4,5,5,6,6,7,7,7-nonafluoroheptoxy)phenyl]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[4-(4,4,5,5,6,6,7,7,7-nonafluoroheptoxy)phenyl]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 88559938 |
| Molecular Formula | C19H19F9O3 |
| Molecular Weight | 466.34 g/mol |
| Exact Mass | 466.12 |
| IUPAC Name | 2-[4-(4,4,5,5,6,6,7,7,7-nonafluoroheptoxy)phenyl]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCc1ccc(OCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H19F9O3/c1-12(2)15(29)31-11-8-13-4-6-14(7-5-13)30-10-3-9-16(20,21)17(22,23)18(24,25)19(26,27)28/h4-7H,1,3,8-11H2,2H3 |
| InChIKey | STYPOIBXCGLSHE-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.34 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|