C32H30O8 — CID 129197747
bis[4-[2-(2-methylprop-2-enoyloxy)ethyl]phenyl] benzene-1,4-dicarboxylate (PubChem CID 129197747) has the molecular formula C32H30O8 and a molecular weight of 542.58 g/mol. Its IUPAC name is bis[4-[2-(2-methylprop-2-enoyloxy)ethyl]phenyl] benzene-1,4-dicarboxylate.
| Compound Name | bis[4-[2-(2-methylprop-2-enoyloxy)ethyl]phenyl] benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 129197747 |
| Molecular Formula | C32H30O8 |
| Molecular Weight | 542.58 g/mol |
| Exact Mass | 542.19 |
| IUPAC Name | bis[4-[2-(2-methylprop-2-enoyloxy)ethyl]phenyl] benzene-1,4-dicarboxylate |
| SMILES | C=C(C)C(=O)OCCc1ccc(OC(=O)c2ccc(C(=O)Oc3ccc(CCOC(=O)C(=C)C)cc3)cc2)cc1 |
| InChI | InChI=1S/C32H30O8/c1-21(2)29(33)37-19-17-23-5-13-27(14-6-23)39-31(35)25-9-11-26(12-10-25)32(36)40-28-15-7-24(8-16-28)18-20-38-30(34)22(3)4/h5-16H,1,3,17-20H2,2,4H3 |
| InChIKey | HNVPDSLOUBGRNK-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.58 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|