C28H24O6 — CID 155219793
[4-[2-(2-methylprop-2-enoyloxy)ethyl]phenyl] 4-(4-prop-2-enoyloxyphenyl)benzoate (PubChem CID 155219793) has the molecular formula C28H24O6 and a molecular weight of 456.49 g/mol. Its IUPAC name is [4-[2-(2-methylprop-2-enoyloxy)ethyl]phenyl] 4-(4-prop-2-enoyloxyphenyl)benzoate.
| Compound Name | [4-[2-(2-methylprop-2-enoyloxy)ethyl]phenyl] 4-(4-prop-2-enoyloxyphenyl)benzoate |
|---|---|
| PubChem CID | 155219793 |
| Molecular Formula | C28H24O6 |
| Molecular Weight | 456.49 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | [4-[2-(2-methylprop-2-enoyloxy)ethyl]phenyl] 4-(4-prop-2-enoyloxyphenyl)benzoate |
| SMILES | C=CC(=O)Oc1ccc(-c2ccc(C(=O)Oc3ccc(CCOC(=O)C(=C)C)cc3)cc2)cc1 |
| InChI | InChI=1S/C28H24O6/c1-4-26(29)33-24-15-11-22(12-16-24)21-7-9-23(10-8-21)28(31)34-25-13-5-20(6-14-25)17-18-32-27(30)19(2)3/h4-16H,1-2,17-18H2,3H3 |
| InChIKey | QBRIWPXWFZRRRJ-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.49 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|