C31H30O9 — CID 167376051
[4-[4-(2-prop-2-enoyloxyethoxy)phenyl]phenyl] 4-[2-hydroxy-3-(2-methylprop-2-enoyloxy)propoxy]benzoate (PubChem CID 167376051) has the molecular formula C31H30O9 and a molecular weight of 546.57 g/mol. Its IUPAC name is [4-[4-(2-prop-2-enoyloxyethoxy)phenyl]phenyl] 4-[2-hydroxy-3-(2-methylprop-2-enoyloxy)propoxy]benzoate.
| Compound Name | [4-[4-(2-prop-2-enoyloxyethoxy)phenyl]phenyl] 4-[2-hydroxy-3-(2-methylprop-2-enoyloxy)propoxy]benzoate |
|---|---|
| PubChem CID | 167376051 |
| Molecular Formula | C31H30O9 |
| Molecular Weight | 546.57 g/mol |
| Exact Mass | 546.19 |
| IUPAC Name | [4-[4-(2-prop-2-enoyloxyethoxy)phenyl]phenyl] 4-[2-hydroxy-3-(2-methylprop-2-enoyloxy)propoxy]benzoate |
| SMILES | C=CC(=O)OCCOc1ccc(-c2ccc(OC(=O)c3ccc(OCC(O)COC(=O)C(=C)C)cc3)cc2)cc1 |
| InChI | InChI=1S/C31H30O9/c1-4-29(33)37-18-17-36-26-11-5-22(6-12-26)23-7-15-28(16-8-23)40-31(35)24-9-13-27(14-10-24)38-19-25(32)20-39-30(34)21(2)3/h4-16,25,32H,1-2,17-20H2,3H3 |
| InChIKey | IPXOXGWMDWTRNB-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.57 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|