C29H25FO7 — CID 139409066
[4-[4-(4-prop-2-enoyloxybutoxy)phenyl]phenyl] 4-(2-fluoroprop-2-enoyloxy)benzoate (PubChem CID 139409066) has the molecular formula C29H25FO7 and a molecular weight of 504.51 g/mol. Its IUPAC name is [4-[4-(4-prop-2-enoyloxybutoxy)phenyl]phenyl] 4-(2-fluoroprop-2-enoyloxy)benzoate.
| Compound Name | [4-[4-(4-prop-2-enoyloxybutoxy)phenyl]phenyl] 4-(2-fluoroprop-2-enoyloxy)benzoate |
|---|---|
| PubChem CID | 139409066 |
| Molecular Formula | C29H25FO7 |
| Molecular Weight | 504.51 g/mol |
| Exact Mass | 504.16 |
| IUPAC Name | [4-[4-(4-prop-2-enoyloxybutoxy)phenyl]phenyl] 4-(2-fluoroprop-2-enoyloxy)benzoate |
| SMILES | C=CC(=O)OCCCCOc1ccc(-c2ccc(OC(=O)c3ccc(OC(=O)C(=C)F)cc3)cc2)cc1 |
| InChI | InChI=1S/C29H25FO7/c1-3-27(31)35-19-5-4-18-34-24-12-6-21(7-13-24)22-8-14-26(15-9-22)37-29(33)23-10-16-25(17-11-23)36-28(32)20(2)30/h3,6-17H,1-2,4-5,18-19H2 |
| InChIKey | VRQXXGDYNHVBHB-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.51 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|