C31H29FO8 — CID 139409065
[4-[4-[4-(2-fluoroprop-2-enoyloxy)butoxy]phenyl]phenyl] 4-(3-ethenoxy-3-oxopropoxy)benzoate (PubChem CID 139409065) has the molecular formula C31H29FO8 and a molecular weight of 548.56 g/mol. Its IUPAC name is [4-[4-[4-(2-fluoroprop-2-enoyloxy)butoxy]phenyl]phenyl] 4-(3-ethenoxy-3-oxopropoxy)benzoate.
| Compound Name | [4-[4-[4-(2-fluoroprop-2-enoyloxy)butoxy]phenyl]phenyl] 4-(3-ethenoxy-3-oxopropoxy)benzoate |
|---|---|
| PubChem CID | 139409065 |
| Molecular Formula | C31H29FO8 |
| Molecular Weight | 548.56 g/mol |
| Exact Mass | 548.18 |
| IUPAC Name | [4-[4-[4-(2-fluoroprop-2-enoyloxy)butoxy]phenyl]phenyl] 4-(3-ethenoxy-3-oxopropoxy)benzoate |
| SMILES | C=COC(=O)CCOc1ccc(C(=O)Oc2ccc(-c3ccc(OCCCCOC(=O)C(=C)F)cc3)cc2)cc1 |
| InChI | InChI=1S/C31H29FO8/c1-3-36-29(33)18-21-38-27-14-10-25(11-15-27)31(35)40-28-16-8-24(9-17-28)23-6-12-26(13-7-23)37-19-4-5-20-39-30(34)22(2)32/h3,6-17H,1-2,4-5,18-21H2 |
| InChIKey | YDPWRHQAPBXNHH-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.56 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|