C38H34O10 — CID 139409109
[4-[4-[4-(4-prop-2-enoyloxybutoxycarbonyloxy)phenyl]phenyl]phenyl] 4-(3-ethenoxy-3-oxopropoxy)benzoate (PubChem CID 139409109) has the molecular formula C38H34O10 and a molecular weight of 650.68 g/mol. Its IUPAC name is [4-[4-[4-(4-prop-2-enoyloxybutoxycarbonyloxy)phenyl]phenyl]phenyl] 4-(3-ethenoxy-3-oxopropoxy)benzoate.
| Compound Name | [4-[4-[4-(4-prop-2-enoyloxybutoxycarbonyloxy)phenyl]phenyl]phenyl] 4-(3-ethenoxy-3-oxopropoxy)benzoate |
|---|---|
| PubChem CID | 139409109 |
| Molecular Formula | C38H34O10 |
| Molecular Weight | 650.68 g/mol |
| Exact Mass | 650.22 |
| IUPAC Name | [4-[4-[4-(4-prop-2-enoyloxybutoxycarbonyloxy)phenyl]phenyl]phenyl] 4-(3-ethenoxy-3-oxopropoxy)benzoate |
| SMILES | C=COC(=O)CCOc1ccc(C(=O)Oc2ccc(-c3ccc(-c4ccc(OC(=O)OCCCCOC(=O)C=C)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C38H34O10/c1-3-35(39)45-24-5-6-25-46-38(42)48-34-21-13-30(14-22-34)28-9-7-27(8-10-28)29-11-19-33(20-12-29)47-37(41)31-15-17-32(18-16-31)44-26-23-36(40)43-4-2/h3-4,7-22H,1-2,5-6,23-26H2 |
| InChIKey | SGZAQYZIIDAVRS-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.68 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|