C38H40O12 — CID 154625073
4-O-ethyl 1-O-[4-[4-[4-[4-(4-prop-2-enoyloxybutoxycarbonyloxy)phenyl]phenoxy]carbonylphenoxy]butyl] 2-methylidenebutanedioate (PubChem CID 154625073) has the molecular formula C38H40O12 and a molecular weight of 688.73 g/mol. Its IUPAC name is 4-O-ethyl 1-O-[4-[4-[4-[4-(4-prop-2-enoyloxybutoxycarbonyloxy)phenyl]phenoxy]carbonylphenoxy]butyl] 2-methylidenebutanedioate.
| Compound Name | 4-O-ethyl 1-O-[4-[4-[4-[4-(4-prop-2-enoyloxybutoxycarbonyloxy)phenyl]phenoxy]carbonylphenoxy]butyl] 2-methylidenebutanedioate |
|---|---|
| PubChem CID | 154625073 |
| Molecular Formula | C38H40O12 |
| Molecular Weight | 688.73 g/mol |
| Exact Mass | 688.25 |
| IUPAC Name | 4-O-ethyl 1-O-[4-[4-[4-[4-(4-prop-2-enoyloxybutoxycarbonyloxy)phenyl]phenoxy]carbonylphenoxy]butyl] 2-methylidenebutanedioate |
| SMILES | C=CC(=O)OCCCCOC(=O)Oc1ccc(-c2ccc(OC(=O)c3ccc(OCCCCOC(=O)C(=C)CC(=O)OCC)cc3)cc2)cc1 |
| InChI | InChI=1S/C38H40O12/c1-4-34(39)46-23-7-9-25-48-38(43)50-33-20-12-29(13-21-33)28-10-18-32(19-11-28)49-37(42)30-14-16-31(17-15-30)45-22-6-8-24-47-36(41)27(3)26-35(40)44-5-2/h4,10-21H,1,3,5-9,22-26H2,2H3 |
| InChIKey | BTBYZXJYQDGHFN-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 149.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.73 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|