C30H34O10 — CID 154624926
4-O-methyl 1-O-[4-[4-[4-(4-prop-2-enoyloxybutoxy)phenoxy]carbonylphenoxy]butyl] 2-methylidenebutanedioate (PubChem CID 154624926) has the molecular formula C30H34O10 and a molecular weight of 554.59 g/mol. Its IUPAC name is 4-O-methyl 1-O-[4-[4-[4-(4-prop-2-enoyloxybutoxy)phenoxy]carbonylphenoxy]butyl] 2-methylidenebutanedioate.
| Compound Name | 4-O-methyl 1-O-[4-[4-[4-(4-prop-2-enoyloxybutoxy)phenoxy]carbonylphenoxy]butyl] 2-methylidenebutanedioate |
|---|---|
| PubChem CID | 154624926 |
| Molecular Formula | C30H34O10 |
| Molecular Weight | 554.59 g/mol |
| Exact Mass | 554.22 |
| IUPAC Name | 4-O-methyl 1-O-[4-[4-[4-(4-prop-2-enoyloxybutoxy)phenoxy]carbonylphenoxy]butyl] 2-methylidenebutanedioate |
| SMILES | C=CC(=O)OCCCCOc1ccc(OC(=O)c2ccc(OCCCCOC(=O)C(=C)CC(=O)OC)cc2)cc1 |
| InChI | InChI=1S/C30H34O10/c1-4-27(31)38-19-7-5-17-37-25-13-15-26(16-14-25)40-30(34)23-9-11-24(12-10-23)36-18-6-8-20-39-29(33)22(2)21-28(32)35-3/h4,9-16H,1-2,5-8,17-21H2,3H3 |
| InChIKey | MSPJBEPYRPBCQP-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.59 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|