C32H36O9 — CID 154624808
4-O-methyl 1-O-[4-[4-[(E)-3-[4-(4-prop-2-enoyloxybutoxy)phenyl]prop-2-enoyl]phenoxy]butyl] 2-methylidenebutanedioate (PubChem CID 154624808) has the molecular formula C32H36O9 and a molecular weight of 564.63 g/mol. Its IUPAC name is 4-O-methyl 1-O-[4-[4-[(E)-3-[4-(4-prop-2-enoyloxybutoxy)phenyl]prop-2-enoyl]phenoxy]butyl] 2-methylidenebutanedioate.
| Compound Name | 4-O-methyl 1-O-[4-[4-[(E)-3-[4-(4-prop-2-enoyloxybutoxy)phenyl]prop-2-enoyl]phenoxy]butyl] 2-methylidenebutanedioate |
|---|---|
| PubChem CID | 154624808 |
| Molecular Formula | C32H36O9 |
| Molecular Weight | 564.63 g/mol |
| Exact Mass | 564.24 |
| IUPAC Name | 4-O-methyl 1-O-[4-[4-[(E)-3-[4-(4-prop-2-enoyloxybutoxy)phenyl]prop-2-enoyl]phenoxy]butyl] 2-methylidenebutanedioate |
| SMILES | C=CC(=O)OCCCCOc1ccc(/C=C/C(=O)c2ccc(OCCCCOC(=O)C(=C)CC(=O)OC)cc2)cc1 |
| InChI | InChI=1S/C32H36O9/c1-4-30(34)40-21-7-5-19-38-27-14-9-25(10-15-27)11-18-29(33)26-12-16-28(17-13-26)39-20-6-8-22-41-32(36)24(2)23-31(35)37-3/h4,9-18H,1-2,5-8,19-23H2,3H3/b18-11+ |
| InChIKey | LRQJGXITDSCRNB-WOJGMQOQSA-N |
| XLogP | 5.29 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.63 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|