C28H30O9 — CID 147423607
4-[4-[(E)-3-oxo-3-[4-(2-prop-2-enoyloxyethoxy)phenoxy]prop-1-enyl]phenoxy]butyl 2-(hydroxymethyl)prop-2-enoate (PubChem CID 147423607) has the molecular formula C28H30O9 and a molecular weight of 510.54 g/mol. Its IUPAC name is 4-[4-[(E)-3-oxo-3-[4-(2-prop-2-enoyloxyethoxy)phenoxy]prop-1-enyl]phenoxy]butyl 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | 4-[4-[(E)-3-oxo-3-[4-(2-prop-2-enoyloxyethoxy)phenoxy]prop-1-enyl]phenoxy]butyl 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 147423607 |
| Molecular Formula | C28H30O9 |
| Molecular Weight | 510.54 g/mol |
| Exact Mass | 510.19 |
| IUPAC Name | 4-[4-[(E)-3-oxo-3-[4-(2-prop-2-enoyloxyethoxy)phenoxy]prop-1-enyl]phenoxy]butyl 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=CC(=O)OCCOc1ccc(OC(=O)/C=C/c2ccc(OCCCCOC(=O)C(=C)CO)cc2)cc1 |
| InChI | InChI=1S/C28H30O9/c1-3-26(30)35-19-18-34-24-11-13-25(14-12-24)37-27(31)15-8-22-6-9-23(10-7-22)33-16-4-5-17-36-28(32)21(2)20-29/h3,6-15,29H,1-2,4-5,16-20H2/b15-8+ |
| InChIKey | DSYYBZXRWDZAQD-OVCLIPMQSA-N |
| XLogP | 3.66 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.54 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|