C48H58O11 — CID 59734899
[4-[4-(6-prop-2-enoyloxyhexoxy)phenyl]phenyl] (E)-3-[3,4-bis(6-prop-2-enoyloxyhexoxy)phenyl]prop-2-enoate (PubChem CID 59734899) has the molecular formula C48H58O11 and a molecular weight of 810.98 g/mol. Its IUPAC name is [4-[4-(6-prop-2-enoyloxyhexoxy)phenyl]phenyl] (E)-3-[3,4-bis(6-prop-2-enoyloxyhexoxy)phenyl]prop-2-enoate.
| Compound Name | [4-[4-(6-prop-2-enoyloxyhexoxy)phenyl]phenyl] (E)-3-[3,4-bis(6-prop-2-enoyloxyhexoxy)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 59734899 |
| Molecular Formula | C48H58O11 |
| Molecular Weight | 810.98 g/mol |
| Exact Mass | 810.40 |
| IUPAC Name | [4-[4-(6-prop-2-enoyloxyhexoxy)phenyl]phenyl] (E)-3-[3,4-bis(6-prop-2-enoyloxyhexoxy)phenyl]prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(-c2ccc(OC(=O)/C=C/c3ccc(OCCCCCCOC(=O)C=C)c(OCCCCCCOC(=O)C=C)c3)cc2)cc1 |
| InChI | InChI=1S/C48H58O11/c1-4-45(49)56-34-16-10-7-13-31-53-41-25-21-39(22-26-41)40-23-27-42(28-24-40)59-48(52)30-20-38-19-29-43(54-32-14-8-11-17-35-57-46(50)5-2)44(37-38)55-33-15-9-12-18-36-58-47(51)6-3/h4-6,19-30,37H,1-3,7-18,31-36H2/b30-20+ |
| InChIKey | BWBOMMYHFRFARW-TWKHWXDSSA-N |
| XLogP | 9.98 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 810.98 |
| LogP ≤ 5 | 9.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|