C24H28O5 — CID 144827008
(E)-3-[6-(8-prop-2-enoyloxyoctoxy)naphthalen-2-yl]prop-2-enoic acid (PubChem CID 144827008) has the molecular formula C24H28O5 and a molecular weight of 396.48 g/mol. Its IUPAC name is (E)-3-[6-(8-prop-2-enoyloxyoctoxy)naphthalen-2-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[6-(8-prop-2-enoyloxyoctoxy)naphthalen-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 144827008 |
| Molecular Formula | C24H28O5 |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | (E)-3-[6-(8-prop-2-enoyloxyoctoxy)naphthalen-2-yl]prop-2-enoic acid |
| SMILES | C=CC(=O)OCCCCCCCCOc1ccc2cc(/C=C/C(=O)O)ccc2c1 |
| InChI | InChI=1S/C24H28O5/c1-2-24(27)29-16-8-6-4-3-5-7-15-28-22-13-12-20-17-19(10-14-23(25)26)9-11-21(20)18-22/h2,9-14,17-18H,1,3-8,15-16H2,(H,25,26)/b14-10+ |
| InChIKey | XLNDEAUNWZDYAV-GXDHUFHOSA-N |
| XLogP | 5.39 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|