C19H22O3 — CID 22598602
6-naphthalen-2-yloxyhexyl prop-2-enoate (PubChem CID 22598602) has the molecular formula C19H22O3 and a molecular weight of 298.38 g/mol. Its IUPAC name is 6-naphthalen-2-yloxyhexyl prop-2-enoate.
| Compound Name | 6-naphthalen-2-yloxyhexyl prop-2-enoate |
|---|---|
| PubChem CID | 22598602 |
| Molecular Formula | C19H22O3 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | 6-naphthalen-2-yloxyhexyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc2ccccc2c1 |
| InChI | InChI=1S/C19H22O3/c1-2-19(20)22-14-8-4-3-7-13-21-18-12-11-16-9-5-6-10-17(16)15-18/h2,5-6,9-12,15H,1,3-4,7-8,13-14H2 |
| InChIKey | KHVSYYOPPZRKLM-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|