C13H16O4 — CID 20566713
4-(4-hydroxyphenoxy)butyl prop-2-enoate (PubChem CID 20566713) has the molecular formula C13H16O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is 4-(4-hydroxyphenoxy)butyl prop-2-enoate.
| Compound Name | 4-(4-hydroxyphenoxy)butyl prop-2-enoate |
|---|---|
| PubChem CID | 20566713 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 4-(4-hydroxyphenoxy)butyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCOc1ccc(O)cc1 |
| InChI | InChI=1S/C13H16O4/c1-2-13(15)17-10-4-3-9-16-12-7-5-11(14)6-8-12/h2,5-8,14H,1,3-4,9-10H2 |
| InChIKey | XOWIVSDDXVFPAW-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|