C30H32O6 — CID 90048613
[4-[2-[4-(6-prop-2-enoyloxyhexoxy)phenyl]ethyl]phenyl] 4-hydroxybenzoate (PubChem CID 90048613) has the molecular formula C30H32O6 and a molecular weight of 488.58 g/mol. Its IUPAC name is [4-[2-[4-(6-prop-2-enoyloxyhexoxy)phenyl]ethyl]phenyl] 4-hydroxybenzoate.
| Compound Name | [4-[2-[4-(6-prop-2-enoyloxyhexoxy)phenyl]ethyl]phenyl] 4-hydroxybenzoate |
|---|---|
| PubChem CID | 90048613 |
| Molecular Formula | C30H32O6 |
| Molecular Weight | 488.58 g/mol |
| Exact Mass | 488.22 |
| IUPAC Name | [4-[2-[4-(6-prop-2-enoyloxyhexoxy)phenyl]ethyl]phenyl] 4-hydroxybenzoate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(CCc2ccc(OC(=O)c3ccc(O)cc3)cc2)cc1 |
| InChI | InChI=1S/C30H32O6/c1-2-29(32)35-22-6-4-3-5-21-34-27-17-9-23(10-18-27)7-8-24-11-19-28(20-12-24)36-30(33)25-13-15-26(31)16-14-25/h2,9-20,31H,1,3-8,21-22H2 |
| InChIKey | XWCYUPUUDYEEKT-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.58 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|