C37H34O10 — CID 58640515
[2-methyl-4-[4-[4-(6-prop-2-enoyloxyhexoxy)benzoyl]oxybenzoyl]oxyphenyl] 4-hydroxybenzoate (PubChem CID 58640515) has the molecular formula C37H34O10 and a molecular weight of 638.67 g/mol. Its IUPAC name is [2-methyl-4-[4-[4-(6-prop-2-enoyloxyhexoxy)benzoyl]oxybenzoyl]oxyphenyl] 4-hydroxybenzoate.
| Compound Name | [2-methyl-4-[4-[4-(6-prop-2-enoyloxyhexoxy)benzoyl]oxybenzoyl]oxyphenyl] 4-hydroxybenzoate |
|---|---|
| PubChem CID | 58640515 |
| Molecular Formula | C37H34O10 |
| Molecular Weight | 638.67 g/mol |
| Exact Mass | 638.22 |
| IUPAC Name | [2-methyl-4-[4-[4-(6-prop-2-enoyloxyhexoxy)benzoyl]oxybenzoyl]oxyphenyl] 4-hydroxybenzoate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(C(=O)Oc2ccc(C(=O)Oc3ccc(OC(=O)c4ccc(O)cc4)c(C)c3)cc2)cc1 |
| InChI | InChI=1S/C37H34O10/c1-3-34(39)44-23-7-5-4-6-22-43-30-16-10-27(11-17-30)35(40)45-31-18-12-28(13-19-31)36(41)46-32-20-21-33(25(2)24-32)47-37(42)26-8-14-29(38)15-9-26/h3,8-21,24,38H,1,4-7,22-23H2,2H3 |
| InChIKey | JZGXYFZCJQCMHV-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 134.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.67 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|