C41H44O14 — CID 58721045
[3-methyl-4-[4-(6-prop-2-enoyloxyhexoxycarbonyloxy)benzoyl]oxyphenyl] 4-(6-prop-2-enoyloxyhexoxycarbonyloxy)benzoate (PubChem CID 58721045) has the molecular formula C41H44O14 and a molecular weight of 760.79 g/mol. Its IUPAC name is [3-methyl-4-[4-(6-prop-2-enoyloxyhexoxycarbonyloxy)benzoyl]oxyphenyl] 4-(6-prop-2-enoyloxyhexoxycarbonyloxy)benzoate.
| Compound Name | [3-methyl-4-[4-(6-prop-2-enoyloxyhexoxycarbonyloxy)benzoyl]oxyphenyl] 4-(6-prop-2-enoyloxyhexoxycarbonyloxy)benzoate |
|---|---|
| PubChem CID | 58721045 |
| Molecular Formula | C41H44O14 |
| Molecular Weight | 760.79 g/mol |
| Exact Mass | 760.27 |
| IUPAC Name | [3-methyl-4-[4-(6-prop-2-enoyloxyhexoxycarbonyloxy)benzoyl]oxyphenyl] 4-(6-prop-2-enoyloxyhexoxycarbonyloxy)benzoate |
| SMILES | C=CC(=O)OCCCCCCOC(=O)Oc1ccc(C(=O)Oc2ccc(OC(=O)c3ccc(OC(=O)OCCCCCCOC(=O)C=C)cc3)c(C)c2)cc1 |
| InChI | InChI=1S/C41H44O14/c1-4-36(42)48-24-10-6-8-12-26-50-40(46)53-32-18-14-30(15-19-32)38(44)52-34-22-23-35(29(3)28-34)55-39(45)31-16-20-33(21-17-31)54-41(47)51-27-13-9-7-11-25-49-37(43)5-2/h4-5,14-23,28H,1-2,6-13,24-27H2,3H3 |
| InChIKey | LHCBZWWFCXQWMC-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 176.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.79 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|