C43H36O14 — CID 59582788
[3-methyl-4-[6-(3-prop-2-enoyloxypropoxycarbonyloxy)naphthalene-2-carbonyl]oxyphenyl] 6-(3-prop-2-enoyloxypropoxycarbonyloxy)naphthalene-2-carboxylate (PubChem CID 59582788) has the molecular formula C43H36O14 and a molecular weight of 776.75 g/mol. Its IUPAC name is [3-methyl-4-[6-(3-prop-2-enoyloxypropoxycarbonyloxy)naphthalene-2-carbonyl]oxyphenyl] 6-(3-prop-2-enoyloxypropoxycarbonyloxy)naphthalene-2-carboxylate.
| Compound Name | [3-methyl-4-[6-(3-prop-2-enoyloxypropoxycarbonyloxy)naphthalene-2-carbonyl]oxyphenyl] 6-(3-prop-2-enoyloxypropoxycarbonyloxy)naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 59582788 |
| Molecular Formula | C43H36O14 |
| Molecular Weight | 776.75 g/mol |
| Exact Mass | 776.21 |
| IUPAC Name | [3-methyl-4-[6-(3-prop-2-enoyloxypropoxycarbonyloxy)naphthalene-2-carbonyl]oxyphenyl] 6-(3-prop-2-enoyloxypropoxycarbonyloxy)naphthalene-2-carboxylate |
| SMILES | C=CC(=O)OCCCOC(=O)Oc1ccc2cc(C(=O)Oc3ccc(OC(=O)c4ccc5cc(OC(=O)OCCCOC(=O)C=C)ccc5c4)c(C)c3)ccc2c1 |
| InChI | InChI=1S/C43H36O14/c1-4-38(44)50-18-6-20-52-42(48)55-35-14-12-28-23-32(10-8-30(28)25-35)40(46)54-34-16-17-37(27(3)22-34)57-41(47)33-11-9-31-26-36(15-13-29(31)24-33)56-43(49)53-21-7-19-51-39(45)5-2/h4-5,8-17,22-26H,1-2,6-7,18-21H2,3H3 |
| InChIKey | JCYBRVVRMNMFNH-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 176.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.75 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|