C30H26O7 — CID 123854949
(6-methylnaphthalen-2-yl) 6-(4-prop-2-enoyloxybutoxycarbonyloxy)naphthalene-2-carboxylate (PubChem CID 123854949) has the molecular formula C30H26O7 and a molecular weight of 498.53 g/mol. Its IUPAC name is (6-methylnaphthalen-2-yl) 6-(4-prop-2-enoyloxybutoxycarbonyloxy)naphthalene-2-carboxylate.
| Compound Name | (6-methylnaphthalen-2-yl) 6-(4-prop-2-enoyloxybutoxycarbonyloxy)naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 123854949 |
| Molecular Formula | C30H26O7 |
| Molecular Weight | 498.53 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | (6-methylnaphthalen-2-yl) 6-(4-prop-2-enoyloxybutoxycarbonyloxy)naphthalene-2-carboxylate |
| SMILES | C=CC(=O)OCCCCOC(=O)Oc1ccc2cc(C(=O)Oc3ccc4cc(C)ccc4c3)ccc2c1 |
| InChI | InChI=1S/C30H26O7/c1-3-28(31)34-14-4-5-15-35-30(33)37-27-13-11-22-17-25(9-8-24(22)19-27)29(32)36-26-12-10-21-16-20(2)6-7-23(21)18-26/h3,6-13,16-19H,1,4-5,14-15H2,2H3 |
| InChIKey | PXTPFSNPQOJJGL-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.53 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|