C46H46O11 — CID 89003490
[3-hydroxy-4-[6-(6-prop-2-enoyloxyhexoxy)naphthalene-2-carbonyl]oxyphenyl] 6-(6-prop-2-enoyloxyhexoxy)naphthalene-2-carboxylate (PubChem CID 89003490) has the molecular formula C46H46O11 and a molecular weight of 774.86 g/mol. Its IUPAC name is [3-hydroxy-4-[6-(6-prop-2-enoyloxyhexoxy)naphthalene-2-carbonyl]oxyphenyl] 6-(6-prop-2-enoyloxyhexoxy)naphthalene-2-carboxylate.
| Compound Name | [3-hydroxy-4-[6-(6-prop-2-enoyloxyhexoxy)naphthalene-2-carbonyl]oxyphenyl] 6-(6-prop-2-enoyloxyhexoxy)naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 89003490 |
| Molecular Formula | C46H46O11 |
| Molecular Weight | 774.86 g/mol |
| Exact Mass | 774.30 |
| IUPAC Name | [3-hydroxy-4-[6-(6-prop-2-enoyloxyhexoxy)naphthalene-2-carbonyl]oxyphenyl] 6-(6-prop-2-enoyloxyhexoxy)naphthalene-2-carboxylate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc2cc(C(=O)Oc3ccc(OC(=O)c4ccc5cc(OCCCCCCOC(=O)C=C)ccc5c4)c(O)c3)ccc2c1 |
| InChI | InChI=1S/C46H46O11/c1-3-43(48)54-25-11-7-5-9-23-52-38-19-17-32-27-36(15-13-34(32)29-38)45(50)56-40-21-22-42(41(47)31-40)57-46(51)37-16-14-35-30-39(20-18-33(35)28-37)53-24-10-6-8-12-26-55-44(49)4-2/h3-4,13-22,27-31,47H,1-2,5-12,23-26H2 |
| InChIKey | UWOMAEQJUMFCOH-UHFFFAOYSA-N |
| XLogP | 9.47 |
| TPSA | 143.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.86 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|