C49H50O11 — CID 59582800
[3-propanoyl-4-[6-(6-prop-2-enoyloxyhexoxy)naphthalene-2-carbonyl]oxyphenyl] 6-(6-prop-2-enoyloxyhexoxy)naphthalene-2-carboxylate (PubChem CID 59582800) has the molecular formula C49H50O11 and a molecular weight of 814.93 g/mol. Its IUPAC name is [3-propanoyl-4-[6-(6-prop-2-enoyloxyhexoxy)naphthalene-2-carbonyl]oxyphenyl] 6-(6-prop-2-enoyloxyhexoxy)naphthalene-2-carboxylate.
| Compound Name | [3-propanoyl-4-[6-(6-prop-2-enoyloxyhexoxy)naphthalene-2-carbonyl]oxyphenyl] 6-(6-prop-2-enoyloxyhexoxy)naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 59582800 |
| Molecular Formula | C49H50O11 |
| Molecular Weight | 814.93 g/mol |
| Exact Mass | 814.34 |
| IUPAC Name | [3-propanoyl-4-[6-(6-prop-2-enoyloxyhexoxy)naphthalene-2-carbonyl]oxyphenyl] 6-(6-prop-2-enoyloxyhexoxy)naphthalene-2-carboxylate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc2cc(C(=O)Oc3ccc(OC(=O)c4ccc5cc(OCCCCCCOC(=O)C=C)ccc5c4)c(C(=O)CC)c3)ccc2c1 |
| InChI | InChI=1S/C49H50O11/c1-4-44(50)43-33-42(59-48(53)38-17-15-36-31-40(21-19-34(36)29-38)55-25-11-7-9-13-27-57-46(51)5-2)23-24-45(43)60-49(54)39-18-16-37-32-41(22-20-35(37)30-39)56-26-12-8-10-14-28-58-47(52)6-3/h5-6,15-24,29-33H,2-4,7-14,25-28H2,1H3 |
| InChIKey | CUYIPIVINTVSGL-UHFFFAOYSA-N |
| XLogP | 10.36 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 814.93 |
| LogP ≤ 5 | 10.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|