C31H30O9 — CID 154605424
methyl 5-(4-ethylbenzoyl)oxy-2-[4-(4-prop-2-enoyloxybutoxy)benzoyl]oxybenzoate (PubChem CID 154605424) has the molecular formula C31H30O9 and a molecular weight of 546.57 g/mol. Its IUPAC name is methyl 5-(4-ethylbenzoyl)oxy-2-[4-(4-prop-2-enoyloxybutoxy)benzoyl]oxybenzoate.
| Compound Name | methyl 5-(4-ethylbenzoyl)oxy-2-[4-(4-prop-2-enoyloxybutoxy)benzoyl]oxybenzoate |
|---|---|
| PubChem CID | 154605424 |
| Molecular Formula | C31H30O9 |
| Molecular Weight | 546.57 g/mol |
| Exact Mass | 546.19 |
| IUPAC Name | methyl 5-(4-ethylbenzoyl)oxy-2-[4-(4-prop-2-enoyloxybutoxy)benzoyl]oxybenzoate |
| SMILES | C=CC(=O)OCCCCOc1ccc(C(=O)Oc2ccc(OC(=O)c3ccc(CC)cc3)cc2C(=O)OC)cc1 |
| InChI | InChI=1S/C31H30O9/c1-4-21-8-10-22(11-9-21)29(33)39-25-16-17-27(26(20-25)31(35)36-3)40-30(34)23-12-14-24(15-13-23)37-18-6-7-19-38-28(32)5-2/h5,8-17,20H,2,4,6-7,18-19H2,1,3H3 |
| InChIKey | JLTWPWBRWQNBQA-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.57 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|