C51H50O18 — CID 130217456
bis[2-methoxycarbonyl-4-[4-(4-prop-2-enoyloxybutoxy)benzoyl]oxyphenyl] cyclopentane-1,3-dicarboxylate (PubChem CID 130217456) has the molecular formula C51H50O18 and a molecular weight of 950.94 g/mol. Its IUPAC name is bis[2-methoxycarbonyl-4-[4-(4-prop-2-enoyloxybutoxy)benzoyl]oxyphenyl] cyclopentane-1,3-dicarboxylate.
| Compound Name | bis[2-methoxycarbonyl-4-[4-(4-prop-2-enoyloxybutoxy)benzoyl]oxyphenyl] cyclopentane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 130217456 |
| Molecular Formula | C51H50O18 |
| Molecular Weight | 950.94 g/mol |
| Exact Mass | 950.30 |
| IUPAC Name | bis[2-methoxycarbonyl-4-[4-(4-prop-2-enoyloxybutoxy)benzoyl]oxyphenyl] cyclopentane-1,3-dicarboxylate |
| SMILES | C=CC(=O)OCCCCOc1ccc(C(=O)Oc2ccc(OC(=O)C3CCC(C(=O)Oc4ccc(OC(=O)c5ccc(OCCCCOC(=O)C=C)cc5)cc4C(=O)OC)C3)c(C(=O)OC)c2)cc1 |
| InChI | InChI=1S/C51H50O18/c1-5-44(52)64-27-9-7-25-62-36-17-13-32(14-18-36)46(54)66-38-21-23-42(40(30-38)50(58)60-3)68-48(56)34-11-12-35(29-34)49(57)69-43-24-22-39(31-41(43)51(59)61-4)67-47(55)33-15-19-37(20-16-33)63-26-8-10-28-65-45(53)6-2/h5-6,13-24,30-31,34-35H,1-2,7-12,25-29H2,3-4H3 |
| InChIKey | GXVVWMTYVWNWBO-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 228.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 69 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 950.94 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|